CAS 1052546-74-3 appears in our catalog under these names: 1-(2,3-Dichlorobenzyl)-1h-pyrazol-5-amine hydrochloride, 95%, 1-((2,3-Dichlorophenyl)methyl)-1H-pyrazol-5-amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(2,3-dichlorophenyl)methyl]pyrazol-3-amine;hydrochloride (CAS 1052546-74-3) is a chemical compound with the molecular formula C10H10Cl3N3 and a molecular weight of 278.6 g/mol. IUPAC name: 2-[(2,3-dichlorophenyl)methyl]pyrazol-3-amine;hydrochloride. InChIKey: DRPMXLLCBVDAEI-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl3N3 |
|---|---|
| Molecular weight | 278.6 g/mol |
| IUPAC name | 2-[(2,3-dichlorophenyl)methyl]pyrazol-3-amine;hydrochloride |
| InChIKey | DRPMXLLCBVDAEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CN2C(=CC=N2)N.Cl |
Computed by PubChem (NCBI)