CAS 232615-99-5 appears in our catalog under these names: 4-(2,4-dichlorophenyl)-3-methyl-1h-pyrazol-5-amine hydrochloride, 95%, 4-(2,4-Dichlorophenyl)-5-methyl-1H-pyrazol-3-amine hydrochloride, 97%, 4-(2,4-Dichlorophenyl)-3-methyl-1H-pyrazol-5-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 0,5g, 50mg.
4-(2,4-dichlorophenyl)-5-methyl-1H-pyrazol-3-amine;hydrochloride (CAS 232615-99-5) is a chemical compound with the molecular formula C10H10Cl3N3 and a molecular weight of 278.6 g/mol. IUPAC name: 4-(2,4-dichlorophenyl)-5-methyl-1H-pyrazol-3-amine;hydrochloride. InChIKey: QEYNXHDXSCVFSS-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl3N3 |
|---|---|
| Molecular weight | 278.6 g/mol |
| IUPAC name | 4-(2,4-dichlorophenyl)-5-methyl-1H-pyrazol-3-amine;hydrochloride |
| InChIKey | QEYNXHDXSCVFSS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)N)C2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)