Products 1052552-74-5

CAS 1052552-74-5 is the registry number for N-(1,1-Dioxidotetrahydrothien-3-yl)-n-ethylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 25g, 50g.

Structural formula: {0} (CAS {1})

N-ethyl-1,1-dioxothiolan-3-amine;hydrochloride (CAS 1052552-74-5) is a chemical compound with the molecular formula C6H14ClNO2S and a molecular weight of 199.70 g/mol. IUPAC name: N-ethyl-1,1-dioxothiolan-3-amine;hydrochloride. InChIKey: YXAPQTQTPBOJKS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H14ClNO2S
Molecular weight199.70 g/mol
IUPAC nameN-ethyl-1,1-dioxothiolan-3-amine;hydrochloride
InChIKeyYXAPQTQTPBOJKS-UHFFFAOYSA-N
SMILESCCNC1CCS(=O)(=O)C1.Cl

Computed by PubChem (NCBI)