Products 1946010-89-4
CAS 1946010-89-4 appears in our catalog under these names: (3S)-3-Methanesulfonylpiperidine hydrochloride, 95%, (S)-3-(Methylsulfonyl)piperidine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
(3S)-3-methylsulfonylpiperidine;hydrochloride (CAS 1946010-89-4) is a chemical compound with the molecular formula C6H14ClNO2S and a molecular weight of 199.70 g/mol. IUPAC name: (3S)-3-methylsulfonylpiperidine;hydrochloride. InChIKey: MRLKRLRBGARQIK-RGMNGODLSA-N.
| Molecular formula | C6H14ClNO2S |
|---|---|
| Molecular weight | 199.70 g/mol |
| IUPAC name | (3S)-3-methylsulfonylpiperidine;hydrochloride |
| InChIKey | MRLKRLRBGARQIK-RGMNGODLSA-N |
| SMILES | CS(=O)(=O)[C@H]1CCCNC1.Cl |
Computed by PubChem (NCBI)