Products 1052688-16-0
CAS 1052688-16-0 appears in our catalog under these names: 2-Benzyl-4-hydroxy-2,3-dihydro-1H-isoindole-1,3-dione, 2-Benzyl-4-hydroxyisoindoline-1,3-dione 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
2-benzyl-4-hydroxyisoindole-1,3-dione (CAS 1052688-16-0) is a chemical compound with the molecular formula C15H11NO3 and a molecular weight of 253.25 g/mol. IUPAC name: 2-benzyl-4-hydroxyisoindole-1,3-dione. InChIKey: LSJDIDLQTWIFLE-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 2-benzyl-4-hydroxyisoindole-1,3-dione |
| InChIKey | LSJDIDLQTWIFLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C3=C(C2=O)C(=CC=C3)O |
Computed by PubChem (NCBI)