CAS 1052707-27-3 is the registry number for (1S,2S)-1,2-Di(naphthalen-1-yl)ethane-1,2-diamine dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1S,2S)-1,2-dinaphthalen-1-ylethane-1,2-diamine;dihydrochloride (CAS 1052707-27-3) is a chemical compound with the molecular formula C22H22Cl2N2 and a molecular weight of 385.3 g/mol. IUPAC name: (1S,2S)-1,2-dinaphthalen-1-ylethane-1,2-diamine;dihydrochloride. InChIKey: SHNGCXWOHADIKG-IXOXMDGESA-N.
| Molecular formula | C22H22Cl2N2 |
|---|---|
| Molecular weight | 385.3 g/mol |
| IUPAC name | (1S,2S)-1,2-dinaphthalen-1-ylethane-1,2-diamine;dihydrochloride |
| InChIKey | SHNGCXWOHADIKG-IXOXMDGESA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2[C@@H]([C@H](C3=CC=CC4=CC=CC=C43)N)N.Cl.Cl |
Computed by PubChem (NCBI)