CAS 1055301-17-1 appears in our catalog under these names: (1R,2R)-1,2-Di(naphthalen-1-yl)ethane-1,2-diamine Dihydrochloride, >98.0%(HPLC)(T), (1R,2R)-1,2-Di-1-naphthalenyl-1,2-ethanediamine Hydrochloride, 98.0%, 98.0%. Offered by: TCI, Chemat. Available pack sizes: 100mg.
(1R,2R)-1,2-dinaphthalen-1-ylethane-1,2-diamine;dihydrochloride (CAS 1055301-17-1) is a chemical compound with the molecular formula C22H22Cl2N2 and a molecular weight of 385.3 g/mol. IUPAC name: (1R,2R)-1,2-dinaphthalen-1-ylethane-1,2-diamine;dihydrochloride. InChIKey: SHNGCXWOHADIKG-XZHZQXPNSA-N.
| Molecular formula | C22H22Cl2N2 |
|---|---|
| Molecular weight | 385.3 g/mol |
| IUPAC name | (1R,2R)-1,2-dinaphthalen-1-ylethane-1,2-diamine;dihydrochloride |
| InChIKey | SHNGCXWOHADIKG-XZHZQXPNSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2[C@H]([C@@H](C3=CC=CC4=CC=CC=C43)N)N.Cl.Cl |
Computed by PubChem (NCBI)