CAS 1052714-12-1 is the registry number for 3'-Deoxy-4-o-methylepisappanol. Offered by: Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
(3R,4R)-3-[(4-hydroxyphenyl)methyl]-4-methoxy-2,4-dihydrochromene-3,7-diol (CAS 1052714-12-1) is a chemical compound with the molecular formula C17H18O5 and a molecular weight of 302.32 g/mol. IUPAC name: (3R,4R)-3-[(4-hydroxyphenyl)methyl]-4-methoxy-2,4-dihydrochromene-3,7-diol. InChIKey: NRDMATSOBGRQDO-IAGOWNOFSA-N.
| Molecular formula | C17H18O5 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | (3R,4R)-3-[(4-hydroxyphenyl)methyl]-4-methoxy-2,4-dihydrochromene-3,7-diol |
| InChIKey | NRDMATSOBGRQDO-IAGOWNOFSA-N |
| SMILES | CO[C@@H]1C2=C(C=C(C=C2)O)OC[C@@]1(CC3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)