Products 112408-68-1
CAS 112408-68-1 is the registry number for 3'-Deoxy-4-O-methylsappanol. Offered by: MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg.
(3R,4S)-3-[(4-hydroxyphenyl)methyl]-4-methoxy-2,4-dihydrochromene-3,7-diol (CAS 112408-68-1) is a chemical compound with the molecular formula C17H18O5 and a molecular weight of 302.32 g/mol. IUPAC name: (3R,4S)-3-[(4-hydroxyphenyl)methyl]-4-methoxy-2,4-dihydrochromene-3,7-diol. InChIKey: NRDMATSOBGRQDO-DLBZAZTESA-N.
| Molecular formula | C17H18O5 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | (3R,4S)-3-[(4-hydroxyphenyl)methyl]-4-methoxy-2,4-dihydrochromene-3,7-diol |
| InChIKey | NRDMATSOBGRQDO-DLBZAZTESA-N |
| SMILES | CO[C@H]1C2=C(C=C(C=C2)O)OC[C@@]1(CC3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)