CAS 105297-30-1 is the registry number for 8-N-Ethylquinoline-5,8-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
8-N-ethylquinoline-5,8-diamine (CAS 105297-30-1) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: 8-N-ethylquinoline-5,8-diamine. InChIKey: LTXICSUQDPHFPC-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 8-N-ethylquinoline-5,8-diamine |
| InChIKey | LTXICSUQDPHFPC-UHFFFAOYSA-N |
| SMILES | CCNC1=C2C(=C(C=C1)N)C=CC=N2 |
Computed by PubChem (NCBI)