CAS 3654-22-6 appears in our catalog under these names: 2,5-Dimethyl-4-phenylpyrazol-3-amine, 98%, 2,5-Dimethyl-4-phenylpyrazol-3-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 1g, 10g.
1,3-dimethyl-4-phenylpyrazol-5-amine (CAS 3654-22-6) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: 1,3-dimethyl-4-phenylpyrazol-5-amine. InChIKey: PBVCIAKCHUXQTA-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 1,3-dimethyl-4-phenylpyrazol-5-amine |
| InChIKey | PBVCIAKCHUXQTA-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C2=CC=CC=C2)N)C |
Computed by PubChem (NCBI)