Products 105314-01-0
CAS 105314-01-0 appears in our catalog under these names: Metoclopramide EP Impurity A-D3, N–Acetyl Metoclopramide–d3. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 50mg.
4-acetamido-5-chloro-N-[2-(diethylamino)ethyl]-2-(trideuteriomethoxy)benzamide (CAS 105314-01-0) is a chemical compound with the molecular formula C16H24ClN3O3 and a molecular weight of 344.85 g/mol. IUPAC name: 4-acetamido-5-chloro-N-[2-(diethylamino)ethyl]-2-(trideuteriomethoxy)benzamide. InChIKey: CUDFIXBYMDJBQT-GKOSEXJESA-N.
| Molecular formula | C16H24ClN3O3 |
|---|---|
| Molecular weight | 344.85 g/mol |
| IUPAC name | 4-acetamido-5-chloro-N-[2-(diethylamino)ethyl]-2-(trideuteriomethoxy)benzamide |
| InChIKey | CUDFIXBYMDJBQT-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=C(C=C1C(=O)NCCN(CC)CC)Cl)NC(=O)C |
Computed by PubChem (NCBI)