CAS 1142192-00-4 is the registry number for tert-Butyl (6-chloro-5-pivalamidopyridin-2-yl)-methylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-[[6-chloro-5-(2,2-dimethylpropanoylamino)-2-pyridinyl]methyl]carbamate (CAS 1142192-00-4) is a chemical compound with the molecular formula C16H24ClN3O3 and a molecular weight of 341.83 g/mol. IUPAC name: tert-butyl N-[[6-chloro-5-(2,2-dimethylpropanoylamino)-2-pyridinyl]methyl]carbamate. InChIKey: FNXWDMLQFVZMRQ-UHFFFAOYSA-N.
| Molecular formula | C16H24ClN3O3 |
|---|---|
| Molecular weight | 341.83 g/mol |
| IUPAC name | tert-butyl N-[[6-chloro-5-(2,2-dimethylpropanoylamino)-2-pyridinyl]methyl]carbamate |
| InChIKey | FNXWDMLQFVZMRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(N=C(C=C1)CNC(=O)OC(C)(C)C)Cl |
Computed by PubChem (NCBI)