CAS 1053656-91-9 appears in our catalog under these names: 2-(3-Chloro-5-trifluoromethyl-pyridin-2-ylamino)-ethanol, 95%, 2-{(3-Chloro-5-(trifluoromethyl)-2-pyridinyl)-amino}-1-ethanol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g, 2,5g, 0,25g.
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethanol (CAS 1053656-91-9) is a chemical compound with the molecular formula C8H8ClF3N2O and a molecular weight of 240.61 g/mol. IUPAC name: 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethanol. InChIKey: MQQPZWGDVJVBGE-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF3N2O |
|---|---|
| Molecular weight | 240.61 g/mol |
| IUPAC name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethanol |
| InChIKey | MQQPZWGDVJVBGE-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)NCCO)C(F)(F)F |
Computed by PubChem (NCBI)