Products 127979-76-4

CAS 127979-76-4 is the registry number for 2-(Trifluoromethoxy)benzimidamide hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(trifluoromethoxy)benzenecarboximidamide;hydrochloride (CAS 127979-76-4) is a chemical compound with the molecular formula C8H8ClF3N2O and a molecular weight of 240.61 g/mol. IUPAC name: 2-(trifluoromethoxy)benzenecarboximidamide;hydrochloride. InChIKey: RTWUEKKBEVKNHU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClF3N2O
Molecular weight240.61 g/mol
IUPAC name2-(trifluoromethoxy)benzenecarboximidamide;hydrochloride
InChIKeyRTWUEKKBEVKNHU-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=N)N)OC(F)(F)F.Cl

Computed by PubChem (NCBI)