CAS 1053657-44-5 is the registry number for Ethyl 2-(4-(trifluoromethyl)phenoxy)acetoacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl 3-oxo-2-[4-(trifluoromethyl)phenoxy]butanoate (CAS 1053657-44-5) is a chemical compound with the molecular formula C13H13F3O4 and a molecular weight of 290.23 g/mol. IUPAC name: ethyl 3-oxo-2-[4-(trifluoromethyl)phenoxy]butanoate. InChIKey: CHYUCOCSYIFYCK-UHFFFAOYSA-N.
| Molecular formula | C13H13F3O4 |
|---|---|
| Molecular weight | 290.23 g/mol |
| IUPAC name | ethyl 3-oxo-2-[4-(trifluoromethyl)phenoxy]butanoate |
| InChIKey | CHYUCOCSYIFYCK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)C)OC1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)