CAS 1186194-84-2 is the registry number for Dimethyl 2-(3-trifluoromethylbenzyl)malonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Dimethyl 2-[[3-(trifluoromethyl)phenyl]methyl]propanedioate (CAS 1186194-84-2) is a chemical compound with the molecular formula C13H13F3O4 and a molecular weight of 290.23 g/mol. IUPAC name: dimethyl 2-[[3-(trifluoromethyl)phenyl]methyl]propanedioate. InChIKey: UUQWWHNDVZKGKL-UHFFFAOYSA-N.
| Molecular formula | C13H13F3O4 |
|---|---|
| Molecular weight | 290.23 g/mol |
| IUPAC name | dimethyl 2-[[3-(trifluoromethyl)phenyl]methyl]propanedioate |
| InChIKey | UUQWWHNDVZKGKL-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC(=CC=C1)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)