CAS 1053658-50-6 is the registry number for 3-(3-Chloro-2-oxo-5-(trifluoromethyl)-1,2-dihydropyridin-1-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]propanoic acid (CAS 1053658-50-6) is a chemical compound with the molecular formula C9H7ClF3NO3 and a molecular weight of 269.60 g/mol. IUPAC name: 3-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]propanoic acid. InChIKey: QAIZAALGMWMUSO-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO3 |
|---|---|
| Molecular weight | 269.60 g/mol |
| IUPAC name | 3-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]propanoic acid |
| InChIKey | QAIZAALGMWMUSO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)N(C=C1C(F)(F)F)CCC(=O)O)Cl |
Computed by PubChem (NCBI)