Products 2411635-93-1
CAS 2411635-93-1 is the registry number for ethyl 4-chloro-2-oxo-6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 4-chloro-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylate (CAS 2411635-93-1) is a chemical compound with the molecular formula C9H7ClF3NO3 and a molecular weight of 269.60 g/mol. IUPAC name: ethyl 4-chloro-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylate. InChIKey: JSAKCONQLYHRRS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO3 |
|---|---|
| Molecular weight | 269.60 g/mol |
| IUPAC name | ethyl 4-chloro-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylate |
| InChIKey | JSAKCONQLYHRRS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(NC1=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)