CAS 105392-20-9 is the registry number for Ethyl 2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)acrylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Ethyl (E)-2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)prop-2-enoate (CAS 105392-20-9) is a chemical compound with the molecular formula C14H14Cl2FNO3 and a molecular weight of 334.2 g/mol. IUPAC name: ethyl (E)-2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)prop-2-enoate. InChIKey: DJRMXRPIBLNZHF-VQHVLOKHSA-N.
| Molecular formula | C14H14Cl2FNO3 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | ethyl (E)-2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)prop-2-enoate |
| InChIKey | DJRMXRPIBLNZHF-VQHVLOKHSA-N |
| SMILES | CCOC(=O)/C(=C/N(C)C)/C(=O)C1=CC(=C(C=C1Cl)Cl)F |
Computed by PubChem (NCBI)