CAS 106648-05-9 is the registry number for Ethyl 2,4-dichloro-α-[(ethylamino)methylene]-5-fluoro-β-oxobenzenepropanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 3-(2,4-dichloro-5-fluorophenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate (CAS 106648-05-9) is a chemical compound with the molecular formula C14H14Cl2FNO3 and a molecular weight of 334.2 g/mol. IUPAC name: ethyl 3-(2,4-dichloro-5-fluorophenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate. InChIKey: FFBMETIQMRQWCR-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl2FNO3 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | ethyl 3-(2,4-dichloro-5-fluorophenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate |
| InChIKey | FFBMETIQMRQWCR-UHFFFAOYSA-N |
| SMILES | CCN=CC(=C(C1=CC(=C(C=C1Cl)Cl)F)O)C(=O)OCC |
Computed by PubChem (NCBI)