CAS 105394-83-0 appears in our catalog under these names: Ciprofloxacin EP Impurity E, Ciprofloxacin Impurity E(EP), Decarboxy Ciprofloxacin, >95% (HPLC), 1-Cyclopropyl-6-fluoro-7-(piperazin-1-yl)quinolin-4(1H)-one (Decarboxylated Compound), Decarboxy Ciprofloxacin. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg, 5mg, 2mg, 250mg.
1-cyclopropyl-6-fluoro-7-piperazin-1-ylquinolin-4-one (CAS 105394-83-0) is a chemical compound with the molecular formula C16H18FN3O and a molecular weight of 287.33 g/mol. IUPAC name: 1-cyclopropyl-6-fluoro-7-piperazin-1-ylquinolin-4-one. InChIKey: QDYUSAJJDOBXBM-UHFFFAOYSA-N.
| Molecular formula | C16H18FN3O |
|---|---|
| Molecular weight | 287.33 g/mol |
| IUPAC name | 1-cyclopropyl-6-fluoro-7-piperazin-1-ylquinolin-4-one |
| InChIKey | QDYUSAJJDOBXBM-UHFFFAOYSA-N |
| SMILES | C1CC1N2C=CC(=O)C3=CC(=C(C=C32)N4CCNCC4)F |
Computed by PubChem (NCBI)