CAS 1190260-34-4 is the registry number for N-(5-Cyclopropyl-3-(3-fluorophenyl)-1H-pyrazol-4-yl)-2-methylpropanamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
N-[5-cyclopropyl-3-(3-fluorophenyl)-1H-pyrazol-4-yl]-2-methylpropanamide (CAS 1190260-34-4) is a chemical compound with the molecular formula C16H18FN3O and a molecular weight of 287.33 g/mol. IUPAC name: N-[5-cyclopropyl-3-(3-fluorophenyl)-1H-pyrazol-4-yl]-2-methylpropanamide. InChIKey: UFUSOUFFEAFKNG-UHFFFAOYSA-N.
| Molecular formula | C16H18FN3O |
|---|---|
| Molecular weight | 287.33 g/mol |
| IUPAC name | N-[5-cyclopropyl-3-(3-fluorophenyl)-1H-pyrazol-4-yl]-2-methylpropanamide |
| InChIKey | UFUSOUFFEAFKNG-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=C(NN=C1C2=CC(=CC=C2)F)C3CC3 |
Computed by PubChem (NCBI)