CAS 1054549-73-3 appears in our catalog under these names: 6–CEPN, 6-CEPN, 99.17%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10 mg, 25 mg, 5 mg.
5,7-dihydroxy-2-(4-hydroxyphenyl)-6-[(E)-2-phenylethenyl]-2,3-dihydrochromen-4-one (CAS 1054549-73-3) is a chemical compound with the molecular formula C23H18O5 and a molecular weight of 374.4 g/mol. IUPAC name: 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-[(E)-2-phenylethenyl]-2,3-dihydrochromen-4-one. InChIKey: WBONVHMXTSZBAF-IZZDOVSWSA-N.
| Molecular formula | C23H18O5 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-[(E)-2-phenylethenyl]-2,3-dihydrochromen-4-one |
| InChIKey | WBONVHMXTSZBAF-IZZDOVSWSA-N |
| SMILES | C1C(OC2=C(C1=O)C(=C(C(=C2)O)/C=C/C3=CC=CC=C3)O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)