Products 1427514-80-4
CAS 1427514-80-4 appears in our catalog under these names: Dimethyl 5'-formyl-[1,1':3',1''-terphenyl]-4,4''-dicarboxylate, 95%, 95%, Dimethyl5'-formyl-[1,1':3',1''-terphenyl]-4,4''-dicarboxylate, 97%, Dimethyl 5'-formyl-[1,1':3',1''-terphenyl]-4,4''-dicarboxylate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 4-[3-formyl-5-(4-methoxycarbonylphenyl)phenyl]benzoate (CAS 1427514-80-4) is a chemical compound with the molecular formula C23H18O5 and a molecular weight of 374.4 g/mol. IUPAC name: methyl 4-[3-formyl-5-(4-methoxycarbonylphenyl)phenyl]benzoate. InChIKey: KSPKRAAONSQVLY-UHFFFAOYSA-N.
| Molecular formula | C23H18O5 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | methyl 4-[3-formyl-5-(4-methoxycarbonylphenyl)phenyl]benzoate |
| InChIKey | KSPKRAAONSQVLY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC(=CC(=C2)C=O)C3=CC=C(C=C3)C(=O)OC |
Computed by PubChem (NCBI)