Products 1054624-77-9
CAS 1054624-77-9 appears in our catalog under these names: Ranolazine-d3, >95% (HPLC), Ranolazine-d3 Dihydrochloride, Ranolazine–d3, Ranolazine-d3, 99.49%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, 5mg, 50 mg, 5 mg, 25 mg, 100 mg.
N-(2,6-dimethylphenyl)-2-[4-[2-hydroxy-3-[2-(trideuteriomethoxy)phenoxy]propyl]piperazin-1-yl]acetamide (CAS 1054624-77-9) is a chemical compound with the molecular formula C24H33N3O4 and a molecular weight of 430.6 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-2-[4-[2-hydroxy-3-[2-(trideuteriomethoxy)phenoxy]propyl]piperazin-1-yl]acetamide. InChIKey: XKLMZUWKNUAPSZ-HPRDVNIFSA-N.
| Molecular formula | C24H33N3O4 |
|---|---|
| Molecular weight | 430.6 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-2-[4-[2-hydroxy-3-[2-(trideuteriomethoxy)phenoxy]propyl]piperazin-1-yl]acetamide |
| InChIKey | XKLMZUWKNUAPSZ-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC=C1OCC(CN2CCN(CC2)CC(=O)NC3=C(C=CC=C3C)C)O |
Computed by PubChem (NCBI)
Synonyms:
Ranolazine-d3, Ranolazine-d3 Dihydrochloride