Products 1393717-46-8
CAS 1393717-46-8 appears in our catalog under these names: Ranolazine Impurity H, Ranolazine Impurity 9, Ranolazine Impurity 11, Ranolazine Impurity 12, m-Ranolazine, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 1mg.
N-(2,6-dimethylphenyl)-2-[4-[2-hydroxy-3-(3-methoxyphenoxy)propyl]piperazin-1-yl]acetamide (CAS 1393717-46-8) is a chemical compound with the molecular formula C24H33N3O4 and a molecular weight of 427.5 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-2-[4-[2-hydroxy-3-(3-methoxyphenoxy)propyl]piperazin-1-yl]acetamide. InChIKey: IMZMNTQZVWHTMZ-UHFFFAOYSA-N.
| Molecular formula | C24H33N3O4 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-2-[4-[2-hydroxy-3-(3-methoxyphenoxy)propyl]piperazin-1-yl]acetamide |
| InChIKey | IMZMNTQZVWHTMZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CN2CCN(CC2)CC(COC3=CC=CC(=C3)OC)O |
Computed by PubChem (NCBI)