Products 1054629-49-0
CAS 1054629-49-0 appears in our catalog under these names: AZD4694, AZD4694, 99%. Offered by: TargetMol, GLPBio, Chemat. Available pack sizes: 5mg, 10mg, 100mg, 25mg, 50mg, 1mg.
2-[2-fluoro-6-(methylamino)-3-pyridinyl]-1-benzofuran-5-ol (CAS 1054629-49-0) is a chemical compound with the molecular formula C14H11FN2O2 and a molecular weight of 258.25 g/mol. IUPAC name: 2-[2-fluoro-6-(methylamino)-3-pyridinyl]-1-benzofuran-5-ol. InChIKey: MYNQXTDIPMCJCR-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2O2 |
|---|---|
| Molecular weight | 258.25 g/mol |
| IUPAC name | 2-[2-fluoro-6-(methylamino)-3-pyridinyl]-1-benzofuran-5-ol |
| InChIKey | MYNQXTDIPMCJCR-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=C(C=C1)C2=CC3=C(O2)C=CC(=C3)O)F |
Computed by PubChem (NCBI)