Products 325729-60-0
CAS 325729-60-0 appears in our catalog under these names: 4-[(2E)-2-[(3-Fluorophenyl)methylidene]hydrazin-1-yl]benzoic acid, 95%, 4-{2-((3-fluorophenyl)methylidene)hydrazin-1-yl}benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-[(2E)-2-[(3-fluorophenyl)methylidene]hydrazinyl]benzoic acid (CAS 325729-60-0) is a chemical compound with the molecular formula C14H11FN2O2 and a molecular weight of 258.25 g/mol. IUPAC name: 4-[(2E)-2-[(3-fluorophenyl)methylidene]hydrazinyl]benzoic acid. InChIKey: USDCYZORRMENHX-CXUHLZMHSA-N.
| Molecular formula | C14H11FN2O2 |
|---|---|
| Molecular weight | 258.25 g/mol |
| IUPAC name | 4-[(2E)-2-[(3-fluorophenyl)methylidene]hydrazinyl]benzoic acid |
| InChIKey | USDCYZORRMENHX-CXUHLZMHSA-N |
| SMILES | C1=CC(=CC(=C1)F)/C=N/NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)