CAS 105496-33-1 appears in our catalog under these names: 5–hydroxy Buspirone, 8-(4-(4-(5-Hydroxypyrimidin-2-yl)piperazin-1-yl)butyl)-8-azaspiro[4.5]decane-7,9-dione, 98%, 5-Hydroxy Buspirone, Buspirone 5-Hydroxy Metabolite, Buspirone Impurity 16. Offered by: GLPBio, Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 1mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
8-[4-[4-(5-hydroxypyrimidin-2-yl)piperazin-1-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione (CAS 105496-33-1) is a chemical compound with the molecular formula C21H31N5O3 and a molecular weight of 401.5 g/mol. IUPAC name: 8-[4-[4-(5-hydroxypyrimidin-2-yl)piperazin-1-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione. InChIKey: WKAUDMPUKWYRBF-UHFFFAOYSA-N.
| Molecular formula | C21H31N5O3 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 8-[4-[4-(5-hydroxypyrimidin-2-yl)piperazin-1-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione |
| InChIKey | WKAUDMPUKWYRBF-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CC(=O)N(C(=O)C2)CCCCN3CCN(CC3)C4=NC=C(C=N4)O |
Computed by PubChem (NCBI)