Products 34661-85-3
CAS 34661-85-3 appears in our catalog under these names: 5-Methylurapidil, Urapidil Impurity 26, Urapidil Impurity 11, 5–Methylurapidil, 5-Methylurapidil, 98.0%. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 5mg.
6-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,3,5-trimethylpyrimidine-2,4-dione (CAS 34661-85-3) is a chemical compound with the molecular formula C21H31N5O3 and a molecular weight of 401.5 g/mol. IUPAC name: 6-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,3,5-trimethylpyrimidine-2,4-dione. InChIKey: HIHZDNKKIUQQSC-UHFFFAOYSA-N.
| Molecular formula | C21H31N5O3 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 6-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,3,5-trimethylpyrimidine-2,4-dione |
| InChIKey | HIHZDNKKIUQQSC-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C(=O)N(C1=O)C)C)NCCCN2CCN(CC2)C3=CC=CC=C3OC |
Computed by PubChem (NCBI)