CAS 105497-63-0 appears in our catalog under these names: (2S,4S,5S,6S)-4-Amino-6-methyltetrahydro-2H-pyran-2,5-diol hydrochloride, 95+%, L-Daunosamine HCl, L-Daunosamine, Hydrochoride, 3-Amino-2,3,6-trideoxy-β-L-lyxo-hexopyranose hydrochloride. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 50mg, 5mg, 10mg.
(2S,4S,5S,6S)-4-amino-6-methyloxane-2,5-diol;hydrochloride (CAS 105497-63-0) is a chemical compound with the molecular formula C6H14ClNO3 and a molecular weight of 183.63 g/mol. IUPAC name: (2S,4S,5S,6S)-4-amino-6-methyloxane-2,5-diol;hydrochloride. InChIKey: JLNTUORJIVKDRG-VKYWDCQCSA-N.
| Molecular formula | C6H14ClNO3 |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | (2S,4S,5S,6S)-4-amino-6-methyloxane-2,5-diol;hydrochloride |
| InChIKey | JLNTUORJIVKDRG-VKYWDCQCSA-N |
| SMILES | C[C@H]1[C@H]([C@H](C[C@H](O1)O)N)O.Cl |
Computed by PubChem (NCBI)