Products 56501-70-3
CAS 56501-70-3 appears in our catalog under these names: 3-Amino-2,3,6-trideoxy-L-arabino-hexose hydrochloride, Mannose Impurity 15. Offered by: Biosynth, Hubei YoungXin. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 200mg.
(3S,4R,5S)-3-amino-4,5-dihydroxyhexanal;hydrochloride (CAS 56501-70-3) is a chemical compound with the molecular formula C6H14ClNO3 and a molecular weight of 183.63 g/mol. IUPAC name: (3S,4R,5S)-3-amino-4,5-dihydroxyhexanal;hydrochloride. InChIKey: FHYCNFQONIRRCV-YCLXABBFSA-N.
| Molecular formula | C6H14ClNO3 |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | (3S,4R,5S)-3-amino-4,5-dihydroxyhexanal;hydrochloride |
| InChIKey | FHYCNFQONIRRCV-YCLXABBFSA-N |
| SMILES | C[C@@H]([C@@H]([C@H](CC=O)N)O)O.Cl |
Computed by PubChem (NCBI)