CAS 10550-79-5 is the registry number for Anagyrine Related Compound 1. Offered by: Chemat Brand. Available pack sizes: on request.
Propane-1,1,3,3-tetracarboxamide (CAS 10550-79-5) is a chemical compound with the molecular formula C7H12N4O4 and a molecular weight of 216.19 g/mol. IUPAC name: propane-1,1,3,3-tetracarboxamide. InChIKey: YITNVPBMLGVYIU-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | propane-1,1,3,3-tetracarboxamide |
| InChIKey | YITNVPBMLGVYIU-UHFFFAOYSA-N |
| SMILES | C(C(C(=O)N)C(=O)N)C(C(=O)N)C(=O)N |
Computed by PubChem (NCBI)