CAS 1196153-01-1 appears in our catalog under these names: 5-Acetamido-6-amino-3-methyluracil hydrate, 98%, 5-Acetylamino-6-amino-3-methyluracil Hydrate, >95% (HPLC), 5-Acetamido-6-amino-3-methyluracil hydrate. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 10mg, 5mg, 2mg, 25mg, 50mg.
N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide;hydrate (CAS 1196153-01-1) is a chemical compound with the molecular formula C7H12N4O4 and a molecular weight of 216.19 g/mol. IUPAC name: N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide;hydrate. InChIKey: UISWGTUSVPTGHL-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide;hydrate |
| InChIKey | UISWGTUSVPTGHL-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(NC(=O)N(C1=O)C)N.O |
Computed by PubChem (NCBI)