Products 1055071-09-4
CAS 1055071-09-4 is the registry number for Methyl 1-(3-chloropyridin-2-yl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 1-(3-chloro-2-pyridinyl)-3-(trifluoromethyl)pyrazole-5-carboxylate (CAS 1055071-09-4) is a chemical compound with the molecular formula C11H7ClF3N3O2 and a molecular weight of 305.64 g/mol. IUPAC name: methyl 1-(3-chloro-2-pyridinyl)-3-(trifluoromethyl)pyrazole-5-carboxylate. InChIKey: WZBMWPSSWFZDHG-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF3N3O2 |
|---|---|
| Molecular weight | 305.64 g/mol |
| IUPAC name | methyl 1-(3-chloro-2-pyridinyl)-3-(trifluoromethyl)pyrazole-5-carboxylate |
| InChIKey | WZBMWPSSWFZDHG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NN1C2=C(C=CC=N2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)