Products 1076235-18-1
CAS 1076235-18-1 is the registry number for CW0134. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-methylpyrrole-2,5-dione (CAS 1076235-18-1) is a chemical compound with the molecular formula C11H7ClF3N3O2 and a molecular weight of 305.64 g/mol. IUPAC name: 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-methylpyrrole-2,5-dione. InChIKey: AWLZJKYMAYUHJU-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF3N3O2 |
|---|---|
| Molecular weight | 305.64 g/mol |
| IUPAC name | 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-methylpyrrole-2,5-dione |
| InChIKey | AWLZJKYMAYUHJU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C1=O)NC2=NC(=C(C=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)