CAS 105512-86-5 appears in our catalog under these names: 4-(4-Cyclohexylphenyl)-1,3-thiazol-2-amine, 95%, 4-(4-Cyclohexylphenyl)-1,3-thiazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 500mg, 1000mg, 2000mg.
4-(4-cyclohexylphenyl)-1,3-thiazol-2-amine (CAS 105512-86-5) is a chemical compound with the molecular formula C15H18N2S and a molecular weight of 258.4 g/mol. IUPAC name: 4-(4-cyclohexylphenyl)-1,3-thiazol-2-amine. InChIKey: MWEXZTFCZYULFR-UHFFFAOYSA-N.
| Molecular formula | C15H18N2S |
|---|---|
| Molecular weight | 258.4 g/mol |
| IUPAC name | 4-(4-cyclohexylphenyl)-1,3-thiazol-2-amine |
| InChIKey | MWEXZTFCZYULFR-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC=C(C=C2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)