CAS 497933-44-5 is the registry number for [4-(1-Adamantyl)-1,3-thiazol-2-yl]acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[4-(1-adamantyl)-1,3-thiazol-2-yl]acetonitrile (CAS 497933-44-5) is a chemical compound with the molecular formula C15H18N2S and a molecular weight of 258.4 g/mol. IUPAC name: 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]acetonitrile. InChIKey: KKWHZLLDUUVCAT-UHFFFAOYSA-N.
| Molecular formula | C15H18N2S |
|---|---|
| Molecular weight | 258.4 g/mol |
| IUPAC name | 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]acetonitrile |
| InChIKey | KKWHZLLDUUVCAT-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CSC(=N4)CC#N |
Computed by PubChem (NCBI)