CAS 1055283-31-2 is the registry number for (3AR,4R,6aS)-2,2-dimethyltetrahydrothieno[3,4-d][1,3]dioxol-4-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3aR,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl] acetate (CAS 1055283-31-2) is a chemical compound with the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. IUPAC name: [(3aR,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl] acetate. InChIKey: BCTJSQNYHKAOSK-BWZBUEFSSA-N.
| Molecular formula | C9H14O4S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | [(3aR,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl] acetate |
| InChIKey | BCTJSQNYHKAOSK-BWZBUEFSSA-N |
| SMILES | CC(=O)O[C@H]1[C@H]2[C@@H](CS1)OC(O2)(C)C |
Computed by PubChem (NCBI)