Products 1342389-46-1
CAS 1342389-46-1 is the registry number for 1-Oxa-9-thiaspiro[5.5]undecan-4-one 9,9-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9,9-dioxo-1-oxa-9lambda6-thiaspiro[5.5]undecan-4-one (CAS 1342389-46-1) is a chemical compound with the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. IUPAC name: 9,9-dioxo-1-oxa-9lambda6-thiaspiro[5.5]undecan-4-one. InChIKey: RYTLFDXQQBWYNJ-UHFFFAOYSA-N.
| Molecular formula | C9H14O4S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 9,9-dioxo-1-oxa-9lambda6-thiaspiro[5.5]undecan-4-one |
| InChIKey | RYTLFDXQQBWYNJ-UHFFFAOYSA-N |
| SMILES | C1COC2(CCS(=O)(=O)CC2)CC1=O |
Computed by PubChem (NCBI)