CAS 1055301-10-4 appears in our catalog under these names: (1R,2R)-1,2-Bis(4-fluorophenyl)ethane-1,2-diamine dihydrochloride, 97%, 97%, (1R,2R)-1,2-Bis(4-fluorophenyl)ethane-1,2-diamine dihydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1R,2R)-1,2-bis(4-fluorophenyl)ethane-1,2-diamine;dihydrochloride (CAS 1055301-10-4) is a chemical compound with the molecular formula C14H16Cl2F2N2 and a molecular weight of 321.2 g/mol. IUPAC name: (1R,2R)-1,2-bis(4-fluorophenyl)ethane-1,2-diamine;dihydrochloride. InChIKey: ILMQMKZMXREKBI-KFWOVWKUSA-N.
| Molecular formula | C14H16Cl2F2N2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | (1R,2R)-1,2-bis(4-fluorophenyl)ethane-1,2-diamine;dihydrochloride |
| InChIKey | ILMQMKZMXREKBI-KFWOVWKUSA-N |
| SMILES | C1=CC(=CC=C1[C@H]([C@@H](C2=CC=C(C=C2)F)N)N)F.Cl.Cl |
Computed by PubChem (NCBI)