CAS 2097935-41-4 is the registry number for 1,1-Bis(3-fluorobenzyl)hydrazine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1-bis[(3-fluorophenyl)methyl]hydrazine;dihydrochloride (CAS 2097935-41-4) is a chemical compound with the molecular formula C14H16Cl2F2N2 and a molecular weight of 321.2 g/mol. IUPAC name: 1,1-bis[(3-fluorophenyl)methyl]hydrazine;dihydrochloride. InChIKey: BJFAQTIEFXLWDW-UHFFFAOYSA-N.
| Molecular formula | C14H16Cl2F2N2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 1,1-bis[(3-fluorophenyl)methyl]hydrazine;dihydrochloride |
| InChIKey | BJFAQTIEFXLWDW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CN(CC2=CC(=CC=C2)F)N.Cl.Cl |
Computed by PubChem (NCBI)