CAS 10558-45-9 is the registry number for N-(4-Amino-2-chlorophenyl)-5-chloro-2-hydroxybenzamide. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 0,5g.
N-(4-amino-2-chlorophenyl)-5-chloro-2-hydroxybenzamide (CAS 10558-45-9) is a chemical compound with the molecular formula C13H10Cl2N2O2 and a molecular weight of 297.13 g/mol. IUPAC name: N-(4-amino-2-chlorophenyl)-5-chloro-2-hydroxybenzamide. InChIKey: UTLJGBYDUIOYNG-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O2 |
|---|---|
| Molecular weight | 297.13 g/mol |
| IUPAC name | N-(4-amino-2-chlorophenyl)-5-chloro-2-hydroxybenzamide |
| InChIKey | UTLJGBYDUIOYNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)NC(=O)C2=C(C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)