CAS 680212-51-5 is the registry number for N-Benzyl-2,3-dichloro-6-nitroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 25mg.
N-benzyl-2,3-dichloro-6-nitroaniline (CAS 680212-51-5) is a chemical compound with the molecular formula C13H10Cl2N2O2 and a molecular weight of 297.13 g/mol. IUPAC name: N-benzyl-2,3-dichloro-6-nitroaniline. InChIKey: QRMROQDRGPNPOF-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O2 |
|---|---|
| Molecular weight | 297.13 g/mol |
| IUPAC name | N-benzyl-2,3-dichloro-6-nitroaniline |
| InChIKey | QRMROQDRGPNPOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=CC(=C2Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)