CAS 1055995-80-6 is the registry number for 4-Bromo-N,N-diethyl-3-fluorobenzenesulfonamide, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-bromo-N,N-diethyl-3-fluorobenzenesulfonamide (CAS 1055995-80-6) is a chemical compound with the molecular formula C10H13BrFNO2S and a molecular weight of 310.19 g/mol. IUPAC name: 4-bromo-N,N-diethyl-3-fluorobenzenesulfonamide. InChIKey: ZURZRTJFWXAIMZ-UHFFFAOYSA-N.
| Molecular formula | C10H13BrFNO2S |
|---|---|
| Molecular weight | 310.19 g/mol |
| IUPAC name | 4-bromo-N,N-diethyl-3-fluorobenzenesulfonamide |
| InChIKey | ZURZRTJFWXAIMZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)Br)F |
Computed by PubChem (NCBI)