CAS 1704097-17-5 is the registry number for 4-Bromo-N-tert-butyl-3-fluorobenzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-bromo-N-tert-butyl-3-fluorobenzenesulfonamide (CAS 1704097-17-5) is a chemical compound with the molecular formula C10H13BrFNO2S and a molecular weight of 310.19 g/mol. IUPAC name: 4-bromo-N-tert-butyl-3-fluorobenzenesulfonamide. InChIKey: KOVFQFUOHXQBGK-UHFFFAOYSA-N.
| Molecular formula | C10H13BrFNO2S |
|---|---|
| Molecular weight | 310.19 g/mol |
| IUPAC name | 4-bromo-N-tert-butyl-3-fluorobenzenesulfonamide |
| InChIKey | KOVFQFUOHXQBGK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC(=C(C=C1)Br)F |
Computed by PubChem (NCBI)