CAS 1056938-59-0 is the registry number for Sodium (E)-2-nitro-3-oxoprop-1-en-1-olate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium (E)-2-nitro-3-oxoprop-1-en-1-olate (CAS 1056938-59-0) is a chemical compound with the molecular formula C3H2NNaO4 and a molecular weight of 139.04 g/mol. IUPAC name: sodium (E)-2-nitro-3-oxoprop-1-en-1-olate. InChIKey: OQMLJRMYSFKMDS-KSMVGCCESA-M.
| Molecular formula | C3H2NNaO4 |
|---|---|
| Molecular weight | 139.04 g/mol |
| IUPAC name | sodium (E)-2-nitro-3-oxoprop-1-en-1-olate |
| InChIKey | OQMLJRMYSFKMDS-KSMVGCCESA-M |
| SMILES | C(=C(\C=O)/[N+](=O)[O-])\[O-].[Na+] |
Computed by PubChem (NCBI)