CAS 34461-00-2 appears in our catalog under these names: Sodium 2-nitro-1,3-dioxopropan-2-ide, 95%, Sodium nitromalonaldehyde monohydrate. Offered by: Fluorochem, GLPBio. Available pack sizes: 1g, 5g, 25g.
Sodium 2-nitro-3-oxoprop-1-en-1-olate (CAS 34461-00-2) is a chemical compound with the molecular formula C3H2NNaO4 and a molecular weight of 139.04 g/mol. IUPAC name: sodium 2-nitro-3-oxoprop-1-en-1-olate. InChIKey: OQMLJRMYSFKMDS-UHFFFAOYSA-M.
| Molecular formula | C3H2NNaO4 |
|---|---|
| Molecular weight | 139.04 g/mol |
| IUPAC name | sodium 2-nitro-3-oxoprop-1-en-1-olate |
| InChIKey | OQMLJRMYSFKMDS-UHFFFAOYSA-M |
| SMILES | C(=C(C=O)[N+](=O)[O-])[O-].[Na+] |
Computed by PubChem (NCBI)