CAS 105774-97-8 is the registry number for 1Z-1-Iodononafluoro(3-methylbut-1-ene), 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(Z)-1,2,3,4,4,4-hexafluoro-1-iodo-3-(trifluoromethyl)but-1-ene (CAS 105774-97-8) is a chemical compound with the molecular formula C5F9I and a molecular weight of 357.94 g/mol. IUPAC name: (Z)-1,2,3,4,4,4-hexafluoro-1-iodo-3-(trifluoromethyl)but-1-ene. InChIKey: KVLZYXPNBHIUMY-UPHRSURJSA-N.
| Molecular formula | C5F9I |
|---|---|
| Molecular weight | 357.94 g/mol |
| IUPAC name | (Z)-1,2,3,4,4,4-hexafluoro-1-iodo-3-(trifluoromethyl)but-1-ene |
| InChIKey | KVLZYXPNBHIUMY-UPHRSURJSA-N |
| SMILES | C(=C(\F)/I)(\C(C(F)(F)F)(C(F)(F)F)F)/F |
Computed by PubChem (NCBI)